| Identification | |
| Name: | 2-Propenoicacid, 3-phenyl- |
| Synonyms: | Cinnamicacid (7CI,8CI);3-Phenyl-2-propenoic acid;3-Phenylacrylic acid;NSC 623441;NSC 9189;Phenylacrylic acid;b-Phenylacrylicacid;Cinnamic acid; |
| CAS: | 621-82-9 |
| EINECS: | 210-708-3 |
| Molecular Formula: | C9H8O2 |
| Molecular Weight: | 148.15862 |
| InChI: | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Density: | 1.2475 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble Appearance:white crystalline powder Transport Information:20kgs Hazard Symbols:Not regulated UN NO. |
| Appearance: | white crystalline powder |
| Specification: | monoclinic crystals Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols | |
 |
|
