| Identification | |
| Name: | 9,10-Bis(chloromethyl)anthracene |
| Synonyms: | 9,10-Di(chloromethyl)anthracene;NSC 81650; |
| CAS: | 10387-13-0 |
| Molecular Formula: | C16H12Cl2 |
| Molecular Weight: | 275.17 |
| InChI: | InChI=1/C16H12Cl2/c17-9-15-11-5-1-2-6-12(11)16(10-18)14-8-4-3-7-13(14)15/h1-8H,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.291 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.69 |
| Solubility: | Insoluble |
| Appearance: | yellow crystals |
| Specification: |
9,10-Bis(chloromethyl)anthracene , its cas register number is 10387-13-0. It also can be called Ethanethioic acid, potassium salt and Anthracene, 9,10-bis(chloromethyl)- . |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Corrosives area. |
| Safety Data | |
 |
|
