| Identification | |
| Name: | p-Anisidine |
| Synonyms: | 4-Aminoanisole; 4-Methoxyaniline; 4-Methoxybenzeneamine; Para-Anisidine; P-Aminoanisole |
| CAS: | 104-94-9 |
| EINECS: | 203-254-2 |
| Molecular Formula: | C7H9NO |
| Molecular Weight: | 123.15 |
| InChI: | InChI=1/C7H9NO/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2431/2811 |
| Density: | 1.06 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5559 |
| Solubility: | Soluble in hot water |
| Appearance: | white, fused crystalline solid, characteristic amine odor |
| Specification: |
?p-Anisidine , its cas register number is 104-94-9. It also can be called 4-Anisidine ; 1-Amino-4-methoxybenzene ; 4-Aminoanisole ; 4-Methoxy-1-aminobenzene ; 4-Methoxyaniline ; 4-Methoxybenzenamine ; 4-Methoxybenzeneamine ; AI3-02392 ;?Aniline, 4-methoxy- ; Aniline, p-methoxy- ; Anisole, p-amino- ; Benzenamine, 4-methoxy- ; CCRIS 917 ; p-Aminoanisole ; p-Anisylamine ; p-Dianisidine ; p-Methoxyaniline ; p-Methoxyphenylamine ; Benzenamine, 4-methoxy- . It is a?white, fused crystalline solid, characteristic amine odor. It may darken on exposure to light and air.?If heated strongly, it may release very toxic fumes of nitrogen oxides. |
| Packinggroup: | III |
| HS Code: | 29222200 |
| Color: | dark gray to brown |
| Usage: | In the manufacture of azo dyes. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
N:Dangerousfortheenvironment
|
 |
|
