| Identification | ||
| Name: | m-Anisidine | |
| Synonyms: | 3-Methoxyaniline; 3-Aminoanisole | |
| CAS: | 536-90-3 | |
| EINECS: | 208-651-4 | |
| Molecular Formula: | C7H9NO | |
| Molecular Weight: | 123.15 | |
| InChI: | InChI=1/C7H9NO/c1-9-7-4-2-3-6(8)5-7/h2-5H,8H2,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2431 | |
| Density: | 1.096 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.58-1.582 | |
| Water Solubility: | <0.1 g/100 mL at 19 ºC | |
| Solubility: | <0.1 g/100 mL at 19 oC in water | |
| Appearance: | Pale yellow oily liquid or dark red liquid. | |
| Specification: |
? m-Anisidine (CAS NO.536-90-3), its Synonyms are 1-Amino-3-methoxybenzene ; 3-Aminoanisole ; 3-Methoxyaniline ; 3-Methoxybenzenamine ; m-Anisylamine ; m-Aminoanisole ; 3-Anisidine ; m-Methoxyaniline ; Benzenamine, 3-methoxy- . It is very poisonous for the blood leading to pink coloration of the skin and inner suffocation. Additionally its vapors are irritanting to eyes, mucous membranes, the respiratory system and skin. | |
| Packinggroup: | III | |
| HS Code: | 29222200 | |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. | |
| Safety Data | ||
| Hazard Symbols |
T+:Verytoxic
N:Dangerousfortheenvironment
|
|
 |
||
