| Identification | |
| Name: | Carbonic acid,potassium sodium salt (8CI,9CI) |
| Synonyms: | Potassiumsodium carbonate (6CI,7CI); Potassium sodium carbonate (KNaCO3); Sodiumpotassium carbonate |
| CAS: | 10424-09-6 |
| Molecular Formula: | CH2 O3 . K . Na |
| Molecular Weight: | 122.1 |
| InChI: | InChI=1/CH2O3.K.Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 169.8°C |
| Boiling Point: | 333.6°C at 760 mmHg |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 169.8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
