| Identification | |
| Name: | Carbonic acid,manganese salt (8CI,9CI) |
| Synonyms: | Carbonicacid (H2CO3), manganese salt; Manganese carbonate |
| CAS: | 17375-37-0 |
| EINECS: | 241-414-3 |
| Molecular Formula: | CH2 O3 . x Mn |
| Molecular Weight: | 114.946949 |
| InChI: | InChI=1/CH2O3.Mn/c2-1(3)4;/h(H2,2,3,4); |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | Decomposes >200 deg C |
| Flash Point: | 169.8°C |
| Boiling Point: | 333.6°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Sol in dil acid; insol in water or alcohol SOL IN AQ CARBON DIOXIDE; INSOL IN AMMONIA Soluble in dilute inorganic acids; almost insoluble in common organic acids, both concentrated and dilute. |
| Flash Point: | 169.8°C |
| Color: | Pink to almost white powder when freshly precipitated; rhombohedral, calcite structure Rose-colored crystals, almost white when precipitated. Pink solid trigonal |
| Safety Data | |
 |
|
