| Identification |
| Name: | 1H-3-Benzazepine-7,8-diol,2,3,4,5-tetrahydro-1-phenyl-3-(2-propen-1-yl)- |
| CAS: | 104422-04-0 |
| Molecular Formula: | C19H21 N O2 |
| Molecular Weight: | 376.29 |
| InChI: | InChI=1/C19H21NO2.BrH/c1-2-9-20-10-8-15-11-18(21)19(22)12-16(15)17(13-20)14-6-4-3-5-7-14;/h2-7,11-12,17,21-22H,1,8-10,13H2;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 245.5°C |
| Boiling Point: | 470.4°Cat760mmHg |
| Density: | 1.157g/cm3 |
| Biological Activity: | Selective dopamine D 1 -like receptor partial agonist (IC 50 values are 19.7 and 2425 nM for binding to D 1 -like and D 2 -like receptors respectively). Centrally active following systemic administration in vivo . |
| Flash Point: | 245.5°C |
| Storage Temperature: | 2-8°C |
| Color: | white or off-white |
| Safety Data |
| |
 |
