| Identification | |
| Name: | 4-Methoxybenzyl alcohol |
| Synonyms: | Anisic alcohol;(4-methoxyphenyl)methanol;Anise alcohol;Benzyl alcohol, p-methoxy-;p-Anisyl alcohol;p-Anisol alcohol;Anisyl alcohol;benzenemethanol, 4-methoxy-;4-Methoxybenzyl alcohol (p-Anisic alcohol, 99.0%);Anisyl Alcohol , Natural; |
| CAS: | 105-13-5 |
| EINECS: | 203-273-6 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-10-8-4-2-7(6-9)3-5-8/h2-5,9H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.1125 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.543-1.546 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Colorless liquid. Floral-like odor. |
| Specification: | CLEAR COLOURLESS TO YELLOWISH LIQUID AFTER MELTING Safety Statements:26-36-45-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29094990 |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
