| Identification | |
| Name: | 4-Hydroxyphenethyl alcohol |
| Synonyms: | Phenethylalcohol, p-hydroxy- (7CI,8CI);Tyrosol (6CI);2-(4-Hydroxyphenyl)ethanol;2-(4-Hydroxyphenyl)ethyl alcohol;2-(p-Hydroxyphenyl)ethanol;4-(2-Hydroxyethyl)phenol;Benzeneethanol,4-hydroxy-;NSC 59876;Tyrosol C;p-(2-Hydroxyethyl)phenol;p-HPEA;p-Hydroxyphenethylalcohol;p-Tyrosol;b-(4-Hydroxyphenyl)ethanol;b-(p-Hydroxyphenyl)ethanol;4-Hydroxyphenylethanol; |
| CAS: | 501-94-0 |
| EINECS: | 207-930-8 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,9-10H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.168 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.577 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | off-white to light beige crystals or crystalline |
| Specification: |
?4-Hydroxyphenethyl alcohol (CAS NO.501-94-0) is also named as 2-(4-Hydroxyphenyl)ethanol ; NSC 59876 ; p-Hydroxyphenethyl alcohol?; 4-Hydroxyphenethyl alcohol ; Benzeneethanol, 4-hydroxy-?.?4-Hydroxyphenethyl alcohol (CAS NO.501-94-0) is?off-white to light beige crystals or crystalline. |
| HS Code: | 29072900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
