| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, 2-(diethylamino)ethyl ester |
| Synonyms: | Methacrylicacid, 2-(diethylamino)ethyl ester (6CI,8CI);2-(N,N-Diethylamino)ethylmethacrylate;2-Diethylaminoethyl methacrylate;Daktose B;Diethyl[2-(methacryloyloxy)ethyl]amine;Diethylaminoethyl methacrylate;GE 710;Light Ester DE;N,N-Diethylaminoethyl methacrylate;NSC 14490;Polydeam;[2-(Methacryloyloxy)ethyl]diethylamine;b-(Diethylamino)ethyl methacrylate;b-(N,N-Diethylamino)ethylmethacrylate; |
| CAS: | 105-16-8 |
| EINECS: | 203-275-7 |
| Molecular Formula: | C10H19NO2 |
| Molecular Weight: | 185.26 |
| InChI: | InChI=1/C10H19NO2/c1-5-11(6-2)7-8-13-10(12)9(3)4/h3,5-8H2,1-2,4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -60°C |
| Flash Point: | 170? |
| Density: | 0.922 |
| Stability: | No data. |
| Refractive index: | 1.444 |
| Appearance: | A clear light colored liquid. |
| Specification: |
2-(Diethylamino)ethyl methacrylate ,its cas register number is 105-16-8.It also can be called 2-Propenoic acid, 2-methyl-, 2- (diethylamino)ethyl ester ; Methacrylic acid, 2- (diethylamino)ethyl ester ; Ethanol, 2- (diethylamino)-, methacrylate (ester) ; 2-(diethylamino)ethyl 2-methylprop-2-enoate and .beta.-(Diethylamino)ethyl methacrylate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 170? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Proposed for or used in manufacture of graft polymers, hair sprays, dental materials, treatment of synthetic pelts, preparation of copolymers for waste water purification. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
