| Identification | |
| Name: | Methyl acetoacetate |
| Synonyms: | MAA; Methyl acetoacetaten 99%; 6-Methoxy-2-(4-Methoxyphenyl)Benzothiophene; Acetoacetic acid methyl ester; Butanoic acid, 3-oxo-, methyl ester: |
| CAS: | 105-45-3 |
| EINECS: | 203-299-8 |
| Molecular Formula: | C5H8O3 |
| Molecular Weight: | 116.12 |
| InChI: | InChI=1/C5H8O3/c1-4(6)3-5(7)8-2/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.077 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4175-1.4295 |
| Solubility: | 460 g/L (20 oC) |
| Appearance: | Colorless liquid. |
| Specification: | Colorless, clear liquid usageEng:Methyl acetoacetate (MAA) is a starting material for the syntheses of alpha-substituted aceto- acetic esters and cyclic compounds, e.g. pyrazole, pyrimidine and coumarin derivatives. Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | Z01 |
| HS Code: | 29183000 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Color: | Colorless liquid |
| Usage: | Methyl acetoacetate (MAA) is a starting material for the syntheses of alpha-substituted aceto- acetic esters and cyclic compounds, e.g. pyrazole, pyrimidine and coumarin derivatives. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
