| Identification |
| Name: | 2-Methoxyethyl acetoacetate |
| Synonyms: | Acetoaceticacid, 2-methoxyethyl ester (8CI); Ethanol, 2-methoxy-, acetoacetate (8CI);2-Methoxyethyl acetoacetate |
| CAS: | 22502-03-0 |
| EINECS: | 245-043-8 |
| Molecular Formula: | C7H12O4 |
| Molecular Weight: | 160.17 |
| InChI: | InChI=1/C7H12O4/c1-6(8)5-7(9)11-4-3-10-2/h3-5H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.09 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.433-1.435 |
| Appearance: | clear, colorless liquid. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | 2-Methoxyethyl acetoacetate is used as intermediate for the syntheses of organic chemicals and pharmaceuticals (e.g. Nimodipine). Product Data Sheet |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
