| Identification | ||
| Name: | 6-Octen-1-ol,3,7-dimethyl- | |
| CAS: | 106-22-9 | |
| EINECS: | 203-375-0 | |
| Molecular Formula: | C10H20 O | |
| Molecular Weight: | 156.27 | |
| InChI: | InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h5,10-11H,4,6-8H2,1-3H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 175kgs | |
| Melting Point: | 77-83oC | |
| Flash Point: | 79 oC | |
| Boiling Point: | 222 C | |
| Density: | 0.854 | |
| Stability: | Stable. Incompatible with oxidizing agents. | |
| Refractive index: | n20/D 1.456(lit.) | |
| Water Solubility: | ||
| Solubility: | Insoluble SOLVENT miscible in alcohol | |
| Appearance: | Clear to pale yellow liquid | |
| Report: |
Citronellol (106-22-9) is reported in EPA TSCA Inventory. | |
| Flash Point: | 79 oC | |
| Usage: | Monomer for resins, oil additive, ore flotation agent, dye acceptor. | |
| Safety Data | ||
| Hazard Symbols |
Xi: Irritant
|
|
 |
||
