| Identification | ||
| Name: | 4-Bromotoluene | |
| Synonyms: | 1-Bromo-4-methylbenzene; p-bromotoluene | |
| CAS: | 106-38-7 | |
| EINECS: | 203-391-8 | |
| Molecular Formula: | C7H7Br | |
| Molecular Weight: | 171.04 | |
| InChI: | InChI=1/C7H7Br/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN No 8027 | |
| Density: | 1.39 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.549 | |
| Water Solubility: | <0.1 g/100 mL at 24 ºC | |
| Solubility: | <0.1 g/100 mL at 24 oC in water | |
| Appearance: | colourless or pale yellow liquid | |
| Specification: | WHITE CRYSTALLINE LOW MELTING MASS Safety Statements:28-61-37/39-26 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 61:Avoid release to the environment. Refer to special instructions safety data sheet 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice | |
| HS Code: | 29036990 | |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Color: | Crystals from absolute alcohol | |
| Usage: | 4-Bromotoluene is used as a solvent (for fats, waxes or resins, and as a medium for carrying out reactions) and as a chemical intermediate. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
