| Identification | ||
| Name: | 2-Bromotoluene | |
| Synonyms: | 1-Bromo-2-methylbenzene; o-Bromotoluene | |
| CAS: | 95-46-5 | |
| EINECS: | 202-421-7 | |
| Molecular Formula: | C7H7Br | |
| Molecular Weight: | 171.04 | |
| InChI: | InChI=1/C7H7Br/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 61669 | |
| Density: | 1.423 | |
| Stability: | Stable. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.555-1.557 | |
| Water Solubility: | <0.1 g/100 mL at 15 ºC | |
| Solubility: | <0.1 g/100 mL at 15 ºC | |
| Appearance: | liquid | |
| Specification: | liquid Safety Statements:36/37/39-37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice | |
| Packinggroup: | I; II; III | |
| HS Code: | 29036990 | |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Color: | COLORLESS LIQ | |
| Usage: | Research chemical. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
