| Identification | |
| Name: | p-Xylene |
| Synonyms: | 1,4-Dimethylbenzene; para-xylene; Dibencoside |
| CAS: | 106-42-3 |
| EINECS: | 203-396-5 |
| Molecular Formula: | C8H10 |
| Molecular Weight: | 106.16 |
| InChI: | InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1307 3/PG 3 |
| Density: | 0.866 |
| Stability: | Stable. Incompatible with oxidizing agents. Hygroscopic. Flammable. |
| Refractive index: | n20/D 1.495(lit.) |
| Solubility: | insoluble |
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:25-45-36/37 25:Avoid contact with eyes 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | III |
| Color: | Colorless plates or prisms at low temp Colorless liquid (Note: A solid below 56 degrees F). Color: Saybolt units +30 (research, pure & technical grades) |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
