| Identification |
| Name: | 2-Bromo-p-xylene |
| Synonyms: | 2,5-Dimethylbromobenzene; 2-Bromo-1,4-dimethylbenzene~2,5-Dimethylbromobenzene |
| CAS: | 553-94-6 |
| EINECS: | 209-055-7 |
| Molecular Formula: | C8H9Br |
| Molecular Weight: | 185.06 |
| InChI: | InChI=1/C8H9Br/c1-6-3-4-7(2)8(9)5-6/h3-5H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 6.1/PG 3 |
| Density: | 1.34 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5495-1.5515 |
| Appearance: | Clear colourless to light yellow liquid |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless liq |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
