| Identification | |
| Name: | p-Cresol |
| Synonyms: | 4-Hydroxytoluene; 4-Methylphenol; p-Cresol 98+ %; PARA-CRESOL; 4-cresol; para cresol |
| CAS: | 106-44-5 |
| EINECS: | 203-398-6 |
| Molecular Formula: | C7H8O |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2076/3455 |
| Density: | 1.034 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Air and light-sensitive. Hygroscopic. |
| Refractive index: | 1.5312 (20 C) |
| Solubility: | 23 g/l SOLVENT |
| Appearance: | Clear to to slightly amber semi solid |
| Packinggroup: | II |
| HS Code: | 29071200 |
| Sensitive: | Light Sensitive |
| Color: | Crystalline solid [Note: A liquid above 95 degees F]. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
