| Identification | |
| Name: | Poly(dicyclopentadiene-co-p-cresol) |
| Synonyms: | Phenol, 4-methyl-, reaction products with dicyclopentadiene and isobutylene;Antioxidant RN-L;Butylated Reaction Product of p-Cresol and Dicyclopentadiene;isobutylene;Polymeric sterically hindered phenol;P-Cresol/dicyclopentadiene butylated reaction product;Butylated reaction prod. of p-cresol and dicyclopentadiene;Polyphenolic Antioxidant Butylated Reaction Product of P-Cresol And Dicyclopentadiene; |
| CAS: | 68610-51-5 |
| EINECS: | 271-867-2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H12.C7H8O.C4H8/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-6-2-4-7(8)5-3-6;1-4(2)3/h1-2,4-5,7-10H,3,6H2;2-5,8H,1H3;1H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 105 ºC |
| Flash Point: | 46.8°C |
| Boiling Point: | 170°C at 760 mmHg |
| Density: | 1.04 g/cm3 |
| Appearance: | light milk-color powder or yellow to brown transparent flakes |
| Specification: |
Poly(dicyclopentadiene-co-p-cresol) (CAS NO.68610-51-5) is light milk-color powder or yellow to brown transparent flakes. It is soluble in benzene, toluene and other organic solvents, insoluble in water. |
| Flash Point: | 46.8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
