| Identification | |
| Name: | 3-Bromofluorobenzene |
| Synonyms: | Bromofluorobenzene; 1-Bromo-3-Fluorobenzene |
| CAS: | 1073-06-9 |
| EINECS: | 214-023-0 |
| Molecular Formula: | C6H4BrF |
| Molecular Weight: | 175 |
| InChI: | InChI=1/C6H4BrF/c7-5-2-1-3-6(8)4-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.567 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.526-1.528 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear colourless tolight yellow liquid |
| Specification: |
??Benzene,1-bromo-3-fluoro- ,?its cas register number is 1073-06-9. It also can be called?1-Bromo-3-fluorobenzene ; 1-Fluoro-3-bromobenzene ; 3-Bromfluorbenzen ; 3-Bromofluorobenzene ; m-Bromofluorobenzene ; m-Fluorobromobenzene ; |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Flammables area |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
