| Identification | |
| Name: | 4-Bromofluorobenzene |
| Synonyms: | Bromofluorobenzenecolorlessliq; 1-bromo-4-fluorobenzene; 4-Fluorobronibenzene; p-Fluoro Bromo Benzene; p-Bromofluorobenzene; 1-bromo-4-fluoro-benzen; 1-Fluoro-4-bromobenzene; 4-Bromfluorbenzol; 4-Fluorbrombenzol; 4-Fluorophenyl bromide; 4-fluorophenylbromide; Benzene, 1-bromo-4-fluoro- |
| CAS: | 460-00-4 |
| EINECS: | 207-300-2 |
| Molecular Formula: | C6H4BrF |
| Molecular Weight: | 175 |
| InChI: | InChI=1/C6H4BrF/c7-5-1-3-6(8)4-2-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 250kgs |
| Density: | 1.593 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.526-1.528 |
| Solubility: | Insoluble |
| Appearance: | White to pale yellow crystalline powder |
| Specification: |
? 4-Bromofluorobenzene ,?its cas register number is 460-00-4. It also can be called 1-bromo-4-fluoro-benzen ; 1-Fluoro-4-bromobenzene ; 4-Bromfluorbenzol ; 4-Fluorbrombenzol ; 4-Fluoro-1-bromobenzene ; 4-Fluorophenyl bromide ; 4-fluorophenylbromide ; Benzene, 1-bromo-4-fluoro- .?4-Bromofluorobenzene (CAS NO.460-00-4) is a?clear colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
