| Identification | |
| Name: | 4-Hydroxycoumarin |
| Synonyms: | 4-hydroxy-1-benzopyran-2-one; 4-coumarinyl alcohol; 4-Hydroxy-chromen-2-one |
| CAS: | 1076-38-6 |
| EINECS: | 214-060-2 |
| Molecular Formula: | C9H6O3 |
| Molecular Weight: | 162.14 |
| InChI: | InChI=1/C9H6O3/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5,10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 165.353oC |
| Boiling Point: | 352.41 oC at 760 mmHg |
| Density: | 1.446 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | soluble in hot water (soluble in alcohols,acetone) |
| Appearance: | light yellow to brown crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29322980 |
| Flash Point: | 165.353oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
