| Identification | |
| Name: | 1,3-dimethylbutylamine |
| Synonyms: | 1,3-Dimethylbutylamine |
| CAS: | 108-09-8 |
| EINECS: | 203-549-6 |
| Molecular Formula: | C6H15N |
| Molecular Weight: | 101.19 |
| InChI: | InChI=1/C6H15N/c1-5(2)4-6(3)7/h5-6H,4,7H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2379 |
| Melting Point: | -63 |
| Density: | 0.717 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4075-1.4095 |
| Solubility: | Very soluble |
| Appearance: | white or almost white powder |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:16-26-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
