| Identification | |
| Name: | 2,6-Lutidine |
| Synonyms: | 2,6-Dimethylpyridine; 2,6-Lutidine 2,6-Dimethylpyridine; 2,6-Dimethyl Pyridine |
| CAS: | 108-48-5 |
| EINECS: | 203-587-3 |
| Molecular Formula: | C7H9N |
| Molecular Weight: | 107.15 |
| InChI: | InChI=1/C7H9N/c1-6-4-3-5-7(2)8-6/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 0.9252 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, acid chlorides, acids, chloroformates. Protect from moisture. |
| Refractive index: | 1.4966-1.4986 |
| Solubility: | 40 g/100 mL (20 oC) in water |
| Appearance: | yellow |
| Specification: | Colorless to yellow liquid usageEng:Isolated from the basic fraction of coal tar. A semi-volatile compound in tobacco. Safety Statements:26-36/37-16-36-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 16:Keep away from sources of ignition - No smoking 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29333999 |
| Color: | Oily liq |
| Usage: | Chemical intermediate for pharmaceuticals, resins, dyestuffs, rubber accelerators, insecticides. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
