| Identification | |
| Name: | Propanedioicacid, 1,3-dimethyl ester |
| Synonyms: | Malonicacid, dimethyl ester (6CI,8CI);Propanedioic acid, dimethyl ester (9CI);Dimethyl 1,3-propanedioate;Dimethyl propanedioate;Methylmalonate;NSC 620046;Dimethyl Malonate (DMM); |
| CAS: | 108-59-8 |
| EINECS: | 203-597-8 |
| Molecular Formula: | C5H8O4 |
| Molecular Weight: | 132.11 |
| InChI: | InChI=1/C5H8O4/c1-8-4(6)3-5(7)9-2/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.156 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. |
| Refractive index: | 1.412-1.414 |
| Water Solubility: | negligible |
| Solubility: | negligible |
| Appearance: | liquid |
| Specification: | liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29171910 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | A common reagent for organic synthesis. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
