Identification |
Name: | 2,4,6-Collidine |
Synonyms: | 2,4,6-Trimethylpyridine; 2,4,6-Collidine 98+ %; sym.-collidine |
CAS: | 108-75-8 |
EINECS: | 203-613-3 |
Molecular Formula: | C8H11N |
Molecular Weight: | 121.18 |
InChI: | InChI=1/C8H11N/c1-6-4-7(2)9-8(3)5-6/h4-5H,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1992 |
Density: | 0.917 |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
Refractive index: | 1.4995-1.5015 |
Solubility: | 35 g/L (20 ºC) |
Appearance: | Colorless liquid. Aromatic odor. |
Specification: | colourless liquid Safety Statements:26-36/37-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 36:Wear suitable protective clothing |
Packinggroup: | III |
HS Code: | 29333999 |
Storage Temperature: | 2-8°C |
Sensitive: | Hygroscopic |
Color: | Colorless liquid |
Usage: | Chemical intermediate. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |