| Identification | |
| Name: | 2,4,6-Collidine |
| Synonyms: | 2,4,6-Trimethylpyridine; 2,4,6-Collidine 98+ %; sym.-collidine |
| CAS: | 108-75-8 |
| EINECS: | 203-613-3 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-6-4-7(2)9-8(3)5-6/h4-5H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Density: | 0.917 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4995-1.5015 |
| Solubility: | 35 g/L (20 ºC) |
| Appearance: | Colorless liquid. Aromatic odor. |
| Specification: | colourless liquid Safety Statements:26-36/37-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 36:Wear suitable protective clothing |
| Packinggroup: | III |
| HS Code: | 29333999 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Hygroscopic |
| Color: | Colorless liquid |
| Usage: | Chemical intermediate. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
