| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, 1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester |
| Synonyms: | 2-Propenoicacid, 2-methyl-, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester (9CI);Methacrylic acid, diester with tetraethylene glycol (6CI,7CI,8CI);Tetraethylene glycol, dimethacrylate (8CI);4G;Light Ester 4G;NSC 84253;TGM 4;TeEGDMA; |
| CAS: | 109-17-1 |
| EINECS: | 203-653-1 |
| Molecular Formula: | C16H26O7 |
| Molecular Weight: | 330.42 |
| InChI: | InChI=1/C16H26O7/c1-13(2)15(17)22-11-9-20-7-5-19-6-8-21-10-12-23-16(18)14(3)4/h1,3,5-12H2,2,4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Melting Point: | 1.07 g/cm3 |
| Density: | 1.082 |
| Refractive index: | 1.463 |
| Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
