| Identification |
| Name: | 2-Propenoic acid,1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester |
| Synonyms: | 2-Propenoicacid, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester (9CI); Acrylic acid, diesterwith tetraethylene glycol (8CI); Acrylic acid, oxybis(ethyleneoxyethylene)ester (6CI); Aronix M 240; E 4EG2A; Kayarad R 268; Miramer M 270; SR 268;TEGDA; Tetraethylene glycol diacrylate; Viscoat 335H; Viscoat 335HP |
| CAS: | 17831-71-9 |
| EINECS: | 241-789-3 |
| Molecular Formula: | C14H22 O7 |
| Molecular Weight: | 302.32028 |
| InChI: | InChI=1S/C14H22O7/c1-3-13(15)20-11-9-18-7-5-17-6-8-19-10-12-21-14(16)4-2/h3-4H,1-2,5-12H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1760 |
| Flash Point: | >110 ºC |
| Density: | 1.11 |
| Stability: | No data. |
| Refractive index: | 1.465 |
| Water Solubility: | H2O: soluble |
| Solubility: | H2O: soluble |
| Appearance: | Pale yellow liquid. |
| Flash Point: | >110 ºC |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
C: Corrosive
|
| |
 |
