| Identification | |
| Name: | 2-Methoxyethyl acetate |
| Synonyms: | Ethylene glycol monomethyl ether acetate; Methyl Cellosolve?acetate; 1-Acetoxy-2-methoxyethane~Ethylene glycol monomethyl ether acetate~Methyl Cellosolve(rg acetate |
| CAS: | 110-49-6 |
| EINECS: | 203-772-9 |
| Molecular Formula: | C5H10O3 |
| Molecular Weight: | 118.13 |
| InChI: | InChI=1/C5H10O3/c1-5(6)8-4-3-7-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1189 3 |
| Density: | 1.004 |
| Refractive index: | n20/D 1.402(lit.) |
| Water Solubility: | Miscible with water |
| Solubility: | Miscible with water |
| Appearance: | Colorless Liquid |
| Packinggroup: | III |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
