Identification |
Name: | Phenol,4-[1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenyl-1-buten-1-yl]- |
Synonyms: | Phenol,4-[1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenyl-1-butenyl]- (9CI); 4OHNDtam |
CAS: | 110025-28-0 |
Molecular Formula: | C25H27 N O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C25H27NO2/c1-3-24(19-7-5-4-6-8-19)25(20-9-13-22(27)14-10-20)21-11-15-23(16-12-21)28-18-17-26-2/h4-16,26-27H,3,17-18H2,1-2H3/b25-24+ |
Molecular Structure: |
![(C25H27NO2) Phenol,4-[1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenyl-1-butenyl]- (9CI); 4OHNDtam](https://img1.guidechem.com/chem/e/dict/187/110025-28-0.jpg) |
Properties |
Flash Point: | 267.9°C |
Boiling Point: | 519.3°Cat760mmHg |
Density: | 1.099g/cm3 |
Refractive index: | 1.598 |
Flash Point: | 267.9°C |
Usage: | A novel active metabolite of the anti-cancer drug Tamoxifen. It showed potent ER binding property, blocked estrogen stimulated growth of breast cancer cell and half maximal inhibition of estrogen responsive gene expression in ER pos. human breast ca |
Safety Data |
|
 |