Identification |
Name: | Phenol,3-[(1E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenyl-1-buten-1-yl]- |
Synonyms: | Phenol,3-[(1E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenyl-1-butenyl]- (9CI); Phenol,3-[1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenyl-1-butenyl]-, (E)-; K 106;N-Desmethyldroloxifene |
CAS: | 83647-33-0 |
Molecular Formula: | C25H27 N O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C25H27NO2/c1-3-24(19-8-5-4-6-9-19)25(21-10-7-11-22(27)18-21)20-12-14-23(15-13-20)28-17-16-26-2/h4-15,18,26-27H,3,16-17H2,1-2H3/b25-24+ |
Molecular Structure: |
|
Properties |
Flash Point: | 275.7°C |
Boiling Point: | 532.3°C at 760 mmHg |
Density: | 1.099g/cm3 |
Refractive index: | 1.598 |
Specification: | Light Tan Solid usageEng:A metabolite of Droloxifene |
Flash Point: | 275.7°C |
Usage: | A metabolite of Droloxifene |
Safety Data |
|
|