| Identification | |
| Name: | Octadecanoic acid,ethenyl ester |
| Synonyms: | Stearicacid, vinyl ester (6CI,8CI); NSC 20891; NSC 5641; Vinyl octadecanoate; Vinylstearate |
| CAS: | 111-63-7 |
| EINECS: | 203-890-0 |
| Molecular Formula: | C20H38 O2 |
| Molecular Weight: | 310.51 |
| InChI: | InChI=1/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h4H,2-3,5-19H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 35-37 °C(lit.) |
| Flash Point: | 113 C (closed cup) |
| Boiling Point: | 145 °C(lit.) |
| Density: | 0.904 g/mL at 25 °C(lit.) |
| Stability: | Stable. Incompatible with acids, bases, strong oxidizing agents. |
| Refractive index: | 1.451 |
| Water Solubility: | Stability Stable. Incompatible with acids, bases, strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meanin |
| Solubility: |
|
| Appearance: | solid |
| Specification: | solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 113 C (closed cup) |
| Safety Data | |
 |
|
