Identification |
Name: | Octadecanoic acid,carboxymethyl ester |
Synonyms: | Stearicacid, carboxymethyl ester (6CI); Stearic acid, ester with glycolic acid(7CI,8CI) |
CAS: | 5767-84-0 |
EINECS: | 227-292-4 |
Molecular Formula: | C20H38 O4 |
Molecular Weight: | 342.51332 |
InChI: | InChI=1/C23H16N2O5/c1-14-11-17(24-22(26)16-6-4-7-18(12-16)25(28)29)9-10-19(14)20-13-15-5-2-3-8-21(15)30-23(20)27/h2-13H,1H3,(H,24,26) |
Molecular Structure: |
 |
Properties |
Flash Point: | 146.2°C |
Boiling Point: | 454.8°Cat760mmHg |
Density: | 0.96g/cm3 |
Refractive index: | 1.696 |
Flash Point: | 146.2°C |
Safety Data |
|
 |