| Identification | |
| Name: | Muramic acid |
| Synonyms: | D-Glucose,2-amino-3-O-(D-1-carboxyethyl)-2-deoxy- (8CI);(R)-2-Amino-3-O-(1-carboxyethyl)-2-deoxy-D-glucose;2-Amino-3-O-(D-1-carboxyethyl)-2-deoxy-D-glucose;D-Glucose,2-amino-3-O-(1-carboxyethyl)-2-deoxy-, (R)-; |
| CAS: | 1114-41-6 |
| EINECS: | 214-214-9 |
| Molecular Formula: | C9H17NO7 |
| Molecular Weight: | 251.23 |
| InChI: | InChI=1/C9H17NO7/c1-3(8(13)14)16-7-5(10)9(15)17-4(2-11)6(7)12/h3-7,9,11-12,15H,2,10H2,1H3,(H,13,14)/t3-,4-,5-,6-,7-,9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.51 g/cm3 |
| Refractive index: | 1.575 |
| Appearance: | White Solid |
| Storage Temperature: | −20°C |
| Usage: |
The N-acetyl derivative of Muramic acid (CAS NO.1114-41-6) is an amino sugar that constitutes the peptidoglycan bacterial cell wall of Gram negative and Gram positive bacteria. Muramic acid is used as a chemical marker for the detection of bacterial contamination. |
| Safety Data | |
 |
|
