| Identification | |
| Name: | Acetylsalicylic acid |
| Synonyms: | o-Acetylsalicylic acid 2-Acetoxybenzoic acid; 2-Acetoxybenzoic acid~Aspirin; aspirin usp; O-Acetylsalicylic acid; Aspirin; Acetoxybenzoic acid; Metronidazolum |
| CAS: | 50-78-2 |
| EINECS: | 200-064-1 |
| Molecular Formula: | C9H8O4 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1851 |
| Boiling Point: | 140 C |
| Density: | 1.35 |
| Stability: | Stable. Keep dry. Incompatible with strong oxidizing agents, strong bases, strong acids, various other compounds such as iodides, iron salts, quinine salts, etc. |
| Solubility: | 1g/100g water @ 37C |
| Appearance: | white to off-white crystalline powder |
| Specification: |
? Aspirin (CAS NO.50-78-2), its Synonyms are Acetylsalicylic acid ; 2-(Acetyloxy)benzoic acid ; 2-Acetoxybenzoic acid ; 2-Carboxyphenyl acetate ; Acesal ; Aceticyl ; Acetilsalicilico ; Acetilum acidulatum ; Benzoic acid, 2-(acetyloxy)- ; O-Acetylsalicylic acid ; Salicylic acid, acetate . It is odorless white crystals or crystalline powder with a slightly bitter taste. |
| Packinggroup: | III |
| Storage Temperature: | Store at RT. |
| Color: | Monoclinic tablets or needle-like crystals Colorless to white, crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
