| Identification | |
| Name: | Iodoacetic acid |
| Synonyms: | - |
| CAS: | 64-69-7 |
| EINECS: | 200-590-1 |
| Molecular Formula: | C2H3IO2 |
| Molecular Weight: | 185.95 |
| InChI: | InChI=1/C2H3IO2/c3-1-2(4)5/h1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2923 |
| Density: | 2.2694 g/cm3 (85 C) |
| Stability: | Stable. Incompatible with strong oxidizing agents, bases, strong reducing agents. Store at -20 C. |
| Solubility: | 600 g/L (20 ºC) |
| Appearance: | white to light yellow crystalline powder |
| Specification: |
Iodoacetic acid (64-69-7),which also can be called for Vitas-BB TBB000669 ; Aceticacid,iodo- ; CH2ICOOH ; IA ; Iodoacetate ; Iodoacetic ; Iodo-aceticaci ; Kyselina jodoctova .When Iodoacetic acid (64-69-7) was heated,it emits toxic fumes of I−. Iodoacetic acid (64-69-7) is a white to light yellow crystalline powder.This chemical is stable and it's incompatible with strong oxidizing agents, bases, strong reducing agents. It should be stored at -20 C.It may be sensitive to heat, light, and air. It's water soluble. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Light Sensitive |
| Color: | faintly yellow |
| Usage: | As chemical intermediate & in manufacture of pharmaceuticals & herbicides halogenated acetic acids. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
C:Corrosive
|
 |
|
