| Identification | |
| Name: | Iodoacetic acid, sodium salt |
| Synonyms: | Sodium iodoacetate |
| CAS: | 305-53-3 |
| EINECS: | 206-165-7 |
| Molecular Formula: | C2H2INaO2 |
| Molecular Weight: | 207.93 |
| InChI: | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 112.3°C |
| Boiling Point: | 262.1°Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | light yellow to yellow-brown powder |
| Specification: |
General Information: As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 112.3°C |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
