| Identification | |
| Name: | Chloroacetic acid, sodium salt |
| Synonyms: | Aceticacid,chloro-,sodiumsalt; chloro-aceticacisodiumsalt; chloroctansodny; dowdefoliant; monoxone; sma; smca; CHLOROACETIC ACID MONOSODIUM SALT; CHLOROACETIC ACID SODIUM SALT; SODIUM MONOCHLORACETATE; SODIUM MONOCHLOROACETATE; SODIUM CHLOROACETATE; Sodum chloroacetate |
| CAS: | 3926-62-3 |
| EINECS: | 223-498-3 |
| Molecular Formula: | C2H2ClNaO2 |
| Molecular Weight: | 116.48 |
| InChI: | InChI=1/C2H3ClO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2659 |
| Density: | 1.399g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.438 |
| Appearance: | white powder |
| Specification: |
? Sodium chloroacetate , with CAS number of 3926-62-3, can be called Caswell No. 755A ; Chloroacetic acid sodium salt ; Chloroctan sodny ; Monoxone ; Sodium monochloroacetate . Sodium chloroacetate (CAS NO.3926-62-3) is used for pesticide, medicine and other organic synthesis. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29154000 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Color: | Monoclinic prisms Colorless or white deliquescent crystals Colorless to light-brownish crystals ...colorless, hygroscopic, crystalline solid, which occurs in monoclinically prismatic structures... |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
