| Identification | |
| Name: | Oleic acid |
| Synonyms: | Metaupon; 9-octadecenoic acid; Octadecenoic acid; oleoate; red oil |
| CAS: | 112-80-1 |
| EINECS: | 204-007-1 |
| Molecular Formula: | C18H34O2 |
| Molecular Weight: | 282.46 |
| InChI: | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1198 3/PG 3 |
| Density: | 0.89 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, aluminium. |
| Refractive index: | 1.4585-1.4605 |
| Water Solubility: | negligible |
| Solubility: | negligible |
| Appearance: | colourless to light yellow viscous liquid |
| Specification: |
? Oleic acid?,?its cas register number is 112-80-1. It also can be called?4-02-00-01641 (Beilstein Handbook Reference) 9-Octadecenoic acid (Z)- ; AI3-01291 ; Acide oleique ; Acide oleique [French] ; BRN 1726542 ; CCRIS 682 ; Caswell No. 619 ; Century cd fatty acid ; EPA Pesticide Chemical Code 031702 ; Elaidoic acid ; Emersol 220 white oleic acid ; Emersol 221 low titer white oleic acid ; Emersol 233LL ; Emersol 6313NF ; Emersol 6321 ; Extra Oleic 80R ; Extra Olein 90R ; Extraolein 90 ; FEMA No. 2815 ; FEMA Number 2815 ; Glycon RO ; Glycon WO ; HSDB 1240?; K 52 ; Lunac O-CA ; Metaupon ; Neo-Fat 92-04 ; Oelsauere ; Oleine 7503 ; Oleinic acid ; Omega-9 Fatty Acids ; Pamolyn ; Tego-oleic 130 ; UNII-2UMI9U37CP ; Vopcolene 27 ; Wecoline OO ; White oleic acid ; Wochem No. 320 ; Z-9-Octadecenoic acid ; cis-Octadec-9-enoic acid ; cis-delta(sup 9)-Octadecenoic acid ; delta9-cis-Oleic acid ; l'Acide oleique . Oleic acid?(CAS NO.112-80-1) is a?colourless to light yellow viscous liquid. And it is a mono-unsaturated omega-9 fatty acid found in various animal and vegetable sources which? the most abundant fatty acid in human adipose tissue. |
| Report: |
Reported in EPA TSCA Inventory. |
| Sensitive: | Air Sensitive |
| Color: | Colorless or nearly colorless liq (above 5-7 deg C) YELLOWISH, OILY LIQUID WATER-WHITE LIQUID |
| Usage: | Adjuvant. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
