| Identification | |
| Name: | oleic acid, compound with 1H-benzotriazole |
| Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with 1H-benzotriazole (1:?);Oleic acid, benzotriazole salt;9-Octadecenoic acid (9Z)-, compd. with 1H-benzotriazole;Oleic acid, compound with 1H-benzotriazole;(9Z)-octadec-9-enoic acid - 2H-benzotriazole (1:1) |
| CAS: | 64653-97-0 |
| EINECS: | 264-996-0 |
| Molecular Formula: | C24H39N3O2 |
| Molecular Weight: | 401.5854 |
| InChI: | InChI=1/C18H34O2.C6H5N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-4-6-5(3-1)7-9-8-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);1-4H,(H,7,8,9)/b10-9-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 270.1°C |
| Safety Data | |
 |
|
