| Identification | |
| Name: | Benzenamine,4-arsenoso- |
| Synonyms: | Aniline,p-arsenoso- (6CI,7CI,8CI); (4-Aminophenyl)arsine oxide;(p-Aminophenyl)arsenoxide; 4-Arsenosobenzenamine; NSC 10876; p-Arsenosoaniline |
| CAS: | 1122-90-3 |
| Molecular Formula: | C6H6 As N O |
| Molecular Weight: | 183.05 |
| InChI: | InChI=1/C6H6AsNO.2H2O/c8-6-3-1-5(7-9)2-4-6;;/h1-4H,8H2;2*1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1557 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
4-Aminophenylarsenoxide , its CAS NO. is 1122-90-3, the synonyms are 3-16-00-00986 (Beilstein Handbook Reference) ; Aniline, p-arsenoso- ; BRN 2827922 ; NSC 10876 ; p-Arsenosoaniline ; Benzenamine, 4-arsenoso- (9CI) . |
| Packinggroup: | III |
| Flash Point: | °C |
| Usage: | A useful reagent for the study of 2-oxoacid dehydrogenase multienzyme complexes |
| Safety Data | |
 |
|
