| Identification | |
| Name: | Benzoic acid,4-arsenoso- |
| Synonyms: | Benzoicacid, p-arsenoso- (7CI,8CI); NSC 12689; NSC 41365 |
| CAS: | 1197-16-6 |
| Molecular Formula: | C7H5 As O3 |
| Molecular Weight: | 212.04 |
| InChI: | InChI=1/C7H5AsO3/c9-7(10)5-1-3-6(8-11)4-2-5/h1-4H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
p-Carboxy phenylarsenoxide , its cas register number is 1197-16-6. It also can be called p-Arsenosobenzoic acid ; Benzoic acid, 4-arsenoso- ; Arsine, oxo(4-carboxy)phenyl- ; and Benzoic acid, p-arsenoso- (8CI) . |
| Flash Point: | °C |
| Safety Data | |
 |
|
