| Identification |
| Name: | 3,5-Dimethoxybenzoic acid |
| Synonyms: | -3,5-DIMETHOXYBENZOIC ACID; AKOS 227-39; AKOS BBS-00007826; AURORA 8636; OTAVA-BB BB7013191651; RARECHEM AL BO 0044; TIMTEC-BB SBB007798; 3,5-dimethoxy-benzoicaci |
| CAS: | 1132-21-4 |
| EINECS: | 214-473-8 |
| Molecular Formula: | C9H10O4 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C9H10O4/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.214 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | slightly soluble (soluble in hot alcohol, ether) |
| Solubility: | slightly soluble (soluble in hot alcohol, ether) |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 29189090 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
