| Identification | |
| Name: | 3,4-Dimethoxybenzoic acid |
| Synonyms: | Veratric acid; 3,4-Dimethoxybenzoic Acid |
| CAS: | 93-07-2 |
| EINECS: | 202-215-7 |
| Molecular Formula: | C9H10O4 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C9H10O4/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5H,1-2H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Flash Point: | > 100 C |
| Boiling Point: | 200 - 210 (0.1 torr) |
| Density: | 1.436 g/cm3 (-100 C) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | slightly soluble |
| Solubility: | partially soluble |
| Appearance: | Clear light brown liquid. |
| HS Code: | 29189090 |
| Flash Point: | > 100 C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | A natural tocopherol with less antioxidant activity than alpha-tocopherol. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
