| Identification | |
| Name: | Benzoic acid,4-hydroxy-, sodium salt (1:1) |
| Synonyms: | Benzoicacid, 4-hydroxy-, monosodium salt (9CI);Benzoic acid, p-hydroxy-, monosodiumsalt (8CI);Benzoic acid, p-hydroxy-, sodium salt (6CI);4-Hydroxybenzoic acidsodium salt;Monosodium 4-hydroxybenzoate;Monosodium p-hydroxybenzoate;Sodium p-hydroxybenzoate;Sodium paraben;p-Hydroxybenzoicacid monosodium salt;p-Hydroxybenzoic acid sodium salt; |
| CAS: | 114-63-6 |
| EINECS: | 204-051-1 |
| Molecular Formula: | C7H6NaO3 |
| Molecular Weight: | 160.11 |
| InChI: | InChI=1/C7H6O3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >300 °C(lit.) |
| Flash Point: | 171.3°C |
| Boiling Point: | 336.2°Cat760mmHg |
| Density: | 1.375g/cm3 |
| Solubility: | Solubility (in 100 g of solution): 99% ethanol 38.75 g (67 deg C); n-butanol 19.5 g (32.5 deg C) Soluble in about 125 parts water, freely in alcohol, slightly in chloroform; soluble in ether, acetone. Practically insoluble in carbon disulfide. In water, 5000 mg/L at 25 deg C |
| Appearance: | White to light beige crystalline powder |
| Specification: | White to light beige crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 171.3°C |
| Storage Temperature: | Store at RT. |
| Color: | White granular crystalline powder consisting of monoclinic prisms |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
