| Identification | |
| Name: | Benzoic acid,4-hydroxy-, ethyl ester, sodium salt (1:1) |
| Synonyms: | Benzoicacid, 4-hydroxy-, ethyl ester, sodium salt (9CI);4-Hydroxybenzoic acid ethyl ester sodiumsalt;E 215;Ethyl 4-hydroxybenzoate sodium salt;Ethyl p-hydroxybenzoatesodium salt;Sodium p-(carbethoxy)phenoxide; |
| CAS: | 35285-68-8 |
| EINECS: | 252-487-6 |
| Molecular Formula: | C9H9NaO3 |
| Molecular Weight: | 188.8 |
| InChI: | InChI=1/C9H10O3.Na/c1-2-12-9(11)7-3-5-8(10)6-4-7;/h3-6,10H,2H2,1H3;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Specification: |
Sodium ethyl p-hydroxybenzoate , its cas register number is 35285-68-8. It also can be called Sodium 4-ethoxycarbonylphenoxide ; p-Hydroxybenzoic acid ethyl ester sodium salt ; and 4-Hydroxybenzoic acid, ethyl ester, sodium salt . |
| Safety Data | |
 |
|
