Identification |
Name: | Benzoic acid,4-hydroxy-, ethyl ester, sodium salt (1:1) |
Synonyms: | Benzoicacid, 4-hydroxy-, ethyl ester, sodium salt (9CI);4-Hydroxybenzoic acid ethyl ester sodiumsalt;E 215;Ethyl 4-hydroxybenzoate sodium salt;Ethyl p-hydroxybenzoatesodium salt;Sodium p-(carbethoxy)phenoxide; |
CAS: | 35285-68-8 |
EINECS: | 252-487-6 |
Molecular Formula: | C9H9NaO3 |
Molecular Weight: | 188.8 |
InChI: | InChI=1/C9H10O3.Na/c1-2-12-9(11)7-3-5-8(10)6-4-7;/h3-6,10H,2H2,1H3;/q;+1/p-1 |
Molecular Structure: |
 |
Properties |
Density: | g/cm3 |
Specification: |
Sodium ethyl p-hydroxybenzoate , its cas register number is 35285-68-8. It also can be called Sodium 4-ethoxycarbonylphenoxide ; p-Hydroxybenzoic acid ethyl ester sodium salt ; and 4-Hydroxybenzoic acid, ethyl ester, sodium salt .
|
Safety Data |
|
 |