| Identification | |
| Name: | Benzeneacetic acid,sodium salt (1:1) |
| Synonyms: | Aceticacid, phenyl-, Na salt (5CI);Acetic acid, phenyl-, sodium salt (8CI);Benzeneacetic acid, sodium salt (9CI);Sodium benzeneacetate; |
| CAS: | 114-70-5 |
| EINECS: | 204-052-7 |
| Molecular Formula: | C8H7NaO2 |
| Molecular Weight: | 136.14792 |
| InChI: | InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -37 |
| Density: | 1.257g/cm3 |
| Stability: | n/a |
| Refractive index: | 1.53 (20 C) |
| Water Solubility: | Stability n/aToxicology No detailed toxicological data available. Toxicity data (The meaning of any toxicological abbreviations which appear in this section is given |
| Solubility: | |
| Appearance: | Clear yellow to brown. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Refrigerator (approx 4 C). |
| Color: | Leaflets on distillation in-vacuo; plates, tablets from petroleum ether Shiny, white plate crystals |
| Safety Data | |
 |
|
