| Identification | |
| Name: | N-Carbobenzyloxy-L-alanine |
| Synonyms: | (2S)-2-phenylmethoxycarbonylaminopropanoate;N-Benzyloxycarbonyl-L-alanine;N-Carbobenzoxyalanine;N-Benzoxycarbonyl-L-alanine;N-[(Benzyloxy)carbonyl]-L-alanine;Carbobenzoxy-L-alanine;Z-Ala-OH;CBZ -L-(+) -Leucinol;N-Cbz-L-Alanine;N-Cbz-L-Ala-OH;Z-L-Alanine;Ala-OH;CBZ-L-Alanine;Cbz-Ala-OH;CBZ-L-Ala -OH ffff;N-Benzyloxycarbonylalanine; |
| CAS: | 1142-20-7 |
| EINECS: | 214-532-8 |
| Molecular Formula: | C11H13NO4 |
| Molecular Weight: | 223.23 |
| InChI: | InChI=1/C11H13NO4/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14)/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 209.1°C |
| Boiling Point: | 356 |
| Density: | 1.246 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -15 o (C=2, ACOH 24 oC) |
| Solubility: | Appearance:White to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | White to off-white crystalline powder |
| Flash Point: | 209.1°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
