| Identification | |
| Name: | N-Carbobenzyloxy-L-threonine methyl ester |
| Synonyms: | Z-Thr-OMe; Z-L-Threonine methyl ester |
| CAS: | 57224-63-2 |
| Molecular Formula: | C13H17NO5 |
| Molecular Weight: | 267.2778 |
| InChI: | InChI=1/C13H17NO5/c1-9(15)11(12(16)18-2)14-13(17)19-8-10-6-4-3-5-7-10/h3-7,9,11,15H,8H2,1-2H3,(H,14,17)/t9-,11+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 92-94 oC |
| Density: | 1.221 g/cm3 |
| Refractive index: | 1.4365 |
| Alpha: | -18 o (C=1, MEOH) |
| Water Solubility: | MISCIBLE |
| Solubility: | miscible |
| Appearance: | white to off-white powder |
| Specification: |
N-Carbobenzyloxy-L-threonine methyl ester , its cas register number is 57224-63-2. It also can be called Z-Thr-OMe ; Z-L-Threonine methyl ester .It is a white to off-white powder. |
| Safety Data | |
 |
|
