| Identification | |
| Name: | 7-Cyanoindoline |
| Synonyms: | 1H-Indole-7-carbonitrile, 2,3-dihydro-;Indolin-7-carbonitril;Indoline-7-carbonitrile;2,3-Dihydro-1H-indole-7-carbonitrile; |
| CAS: | 115661-82-0 |
| Molecular Formula: | C9H8N2 |
| Molecular Weight: | 144.17 |
| InChI: | InChI=1/C9H8N2/c10-6-8-3-1-2-7-4-5-11-9(7)8/h1-3,11H,4-5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.18 |
| Refractive index: | 1.612 |
| Specification: |
The 7-Cyanoindoline, with the CAS registry number 115661-82-0, has the systematic name of 2,3-dihydro-1H-indole-7-carbonitrile. It is a kind of organics, and should be stored at dry and cool environment. And the molecular formula of the chemical is C9H8N2. The characteristics of 7-Cyanoindoline are as followings: (1)ACD/LogP: 1.40; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.4; (4)ACD/LogD (pH 7.4): 1.4; (5)ACD/BCF (pH 5.5): 6.83; (6)ACD/BCF (pH 7.4): 6.83; (7)ACD/KOC (pH 5.5): 137.58; (8)ACD/KOC (pH 7.4): 137.76; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 27.03 Å2; (13)Index of Refraction: 1.612; (14)Molar Refractivity: 42.17 cm3; (15)Molar Volume: 121.2 cm3; (16)Polarizability: 16.72×10-24cm3; (17)Surface Tension: 53.7 dyne/cm; (18)Density: 1.18 g/cm3; (19)Flash Point: 138.4 °C; (20)Enthalpy of Vaporization: 54.56 kJ/mol; (21)Boiling Point: 305.2 °C at 760 mmHg; (22)Vapour Pressure: 0.000836 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
